ChemNet > CAS > 175278-50-9 3-{4-[(4-methylfenyl)thio]-3-nitrofenyl}acrylzuur
175278-50-9 3-{4-[(4-methylfenyl)thio]-3-nitrofenyl}acrylzuur
| Naam product |
3-{4-[(4-methylfenyl)thio]-3-nitrofenyl}acrylzuur |
| Synoniemen |
3-[4-[(4-methylfenyl)thio]-3-nitrofenyl]acrylzuur; (2E)-3-{4-[(4-methylfenyl)sulfanyl]-3-nitrofenyl}prop-2-eenzuur |
| Engelse naam |
3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid; 3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid |
| MF |
C16H13NO4S |
| Molecuulgewicht |
315.3437 |
| InChI |
InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+ |
| CAS-nummer |
175278-50-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.38g/cm3 |
| Smeltpunt |
217℃ |
| Kookpunt |
505°C at 760 mmHg |
| Brekingsindex |
1.673 |
| Vlampunt |
259.2°C |
| Dampdruk |
5.08E-11mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|